C12H16F3NO — CID 163508501
(1R)-1-[5-methoxy-3-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]-N-methylprop-2-en-1-amine (PubChem CID 163508501) has the molecular formula C12H16F3NO and a molecular weight of 247.26 g/mol. Its IUPAC name is (1R)-1-[5-methoxy-3-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]-N-methylprop-2-en-1-amine.
| Compound Name | (1R)-1-[5-methoxy-3-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]-N-methylprop-2-en-1-amine |
|---|---|
| PubChem CID | 163508501 |
| Molecular Formula | C12H16F3NO |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | (1R)-1-[5-methoxy-3-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]-N-methylprop-2-en-1-amine |
| SMILES | C=C[C@@H](NC)C1=CC(C(F)(F)F)CC(OC)=C1 |
| InChI | InChI=1S/C12H16F3NO/c1-4-11(16-2)8-5-9(12(13,14)15)7-10(6-8)17-3/h4-6,9,11,16H,1,7H2,2-3H3/t9?,11-/m1/s1 |
| InChIKey | DAQKHFYNHFQGOJ-HCCKASOXSA-N |
| XLogP | 2.80 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|