C9H12F2 — CID 178056899
2-(difluoromethyl)-1-ethylcyclohexa-1,3-diene (PubChem CID 178056899) has the molecular formula C9H12F2 and a molecular weight of 158.19 g/mol. Its IUPAC name is 2-(difluoromethyl)-1-ethylcyclohexa-1,3-diene.
| Compound Name | 2-(difluoromethyl)-1-ethylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 178056899 |
| Molecular Formula | C9H12F2 |
| Molecular Weight | 158.19 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | 2-(difluoromethyl)-1-ethylcyclohexa-1,3-diene |
| SMILES | CCC1=C(C(F)F)C=CCC1 |
| InChI | InChI=1S/C9H12F2/c1-2-7-5-3-4-6-8(7)9(10)11/h4,6,9H,2-3,5H2,1H3 |
| InChIKey | OJPLWCDOQLRZHD-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.19 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |