C8H13N — CID 143824141
2-ethylcyclohexa-1,5-dien-1-amine (PubChem CID 143824141) has the molecular formula C8H13N and a molecular weight of 123.20 g/mol. Its IUPAC name is 2-ethylcyclohexa-1,5-dien-1-amine.
| Compound Name | 2-ethylcyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 143824141 |
| Molecular Formula | C8H13N |
| Molecular Weight | 123.20 g/mol |
| Exact Mass | 123.10 |
| IUPAC Name | 2-ethylcyclohexa-1,5-dien-1-amine |
| SMILES | CCC1=C(N)C=CCC1 |
| InChI | InChI=1S/C8H13N/c1-2-7-5-3-4-6-8(7)9/h4,6H,2-3,5,9H2,1H3 |
| InChIKey | HGEJHDDROBMIIW-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.20 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |