C16H20F3NO — CID 142335260
1-ethyl-2-[6-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]cyclohexa-1,3-diene;formamide (PubChem CID 142335260) has the molecular formula C16H20F3NO and a molecular weight of 299.34 g/mol. Its IUPAC name is 1-ethyl-2-[6-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]cyclohexa-1,3-diene;formamide.
| Compound Name | 1-ethyl-2-[6-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]cyclohexa-1,3-diene;formamide |
|---|---|
| PubChem CID | 142335260 |
| Molecular Formula | C16H20F3NO |
| Molecular Weight | 299.34 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 1-ethyl-2-[6-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]cyclohexa-1,3-diene;formamide |
| SMILES | CCC1=C(C2C=CC=CC2C(F)(F)F)C=CCC1.NC=O |
| InChI | InChI=1S/C15H17F3.CH3NO/c1-2-11-7-3-4-8-12(11)13-9-5-6-10-14(13)15(16,17)18;2-1-3/h4-6,8-10,13-14H,2-3,7H2,1H3;1H,(H2,2,3) |
| InChIKey | IZLCQUFGCCUKRE-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.34 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|