C14H16O2S — CID 68911382
(2-ethylcyclohexa-1,5-dien-1-yl)sulfonylbenzene (PubChem CID 68911382) has the molecular formula C14H16O2S and a molecular weight of 248.35 g/mol. Its IUPAC name is (2-ethylcyclohexa-1,5-dien-1-yl)sulfonylbenzene.
| Compound Name | (2-ethylcyclohexa-1,5-dien-1-yl)sulfonylbenzene |
|---|---|
| PubChem CID | 68911382 |
| Molecular Formula | C14H16O2S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | (2-ethylcyclohexa-1,5-dien-1-yl)sulfonylbenzene |
| SMILES | CCC1=C(S(=O)(=O)c2ccccc2)C=CCC1 |
| InChI | InChI=1S/C14H16O2S/c1-2-12-8-6-7-11-14(12)17(15,16)13-9-4-3-5-10-13/h3-5,7,9-11H,2,6,8H2,1H3 |
| InChIKey | SFFKAIFXRXWMSS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |