C10H15N — CID 67050807
2-ethylcycloocta-1,3,5-trien-1-amine (PubChem CID 67050807) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is 2-ethylcycloocta-1,3,5-trien-1-amine.
| Compound Name | 2-ethylcycloocta-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 67050807 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 2-ethylcycloocta-1,3,5-trien-1-amine |
| SMILES | CCC1=C(N)CCC=CC=C1 |
| InChI | InChI=1S/C10H15N/c1-2-9-7-5-3-4-6-8-10(9)11/h3-5,7H,2,6,8,11H2,1H3 |
| InChIKey | WNSDNAGLZQVXLA-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |