C10H17N — CID 143938092
3,4-diethylcyclohexa-1,3-dien-1-amine (PubChem CID 143938092) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is 3,4-diethylcyclohexa-1,3-dien-1-amine.
| Compound Name | 3,4-diethylcyclohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 143938092 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 3,4-diethylcyclohexa-1,3-dien-1-amine |
| SMILES | CCC1=C(CC)CCC(N)=C1 |
| InChI | InChI=1S/C10H17N/c1-3-8-5-6-10(11)7-9(8)4-2/h7H,3-6,11H2,1-2H3 |
| InChIKey | GUGITKJDUPQKIG-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |