C16H21N — CID 159393837
3-ethyl-5,5-dimethyl-4-phenylcyclohexa-1,3-dien-1-amine (PubChem CID 159393837) has the molecular formula C16H21N and a molecular weight of 227.35 g/mol. Its IUPAC name is 3-ethyl-5,5-dimethyl-4-phenylcyclohexa-1,3-dien-1-amine.
| Compound Name | 3-ethyl-5,5-dimethyl-4-phenylcyclohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 159393837 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | 3-ethyl-5,5-dimethyl-4-phenylcyclohexa-1,3-dien-1-amine |
| SMILES | CCC1=C(c2ccccc2)C(C)(C)CC(N)=C1 |
| InChI | InChI=1S/C16H21N/c1-4-12-10-14(17)11-16(2,3)15(12)13-8-6-5-7-9-13/h5-10H,4,11,17H2,1-3H3 |
| InChIKey | RBQYYPAYMSKKHK-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |