C16H20 — CID 150694996
2-ethyl-6,6-dimethyl-1-phenylcyclohexa-1,3-diene (PubChem CID 150694996) has the molecular formula C16H20 and a molecular weight of 212.34 g/mol. Its IUPAC name is 2-ethyl-6,6-dimethyl-1-phenylcyclohexa-1,3-diene.
| Compound Name | 2-ethyl-6,6-dimethyl-1-phenylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 150694996 |
| Molecular Formula | C16H20 |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | 2-ethyl-6,6-dimethyl-1-phenylcyclohexa-1,3-diene |
| SMILES | CCC1=C(c2ccccc2)C(C)(C)CC=C1 |
| InChI | InChI=1S/C16H20/c1-4-13-11-8-12-16(2,3)15(13)14-9-6-5-7-10-14/h5-11H,4,12H2,1-3H3 |
| InChIKey | JKQVHPLPWYISLZ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |