C15H16O2 — CID 150890312
3,3-dimethyl-2-phenylcyclohexa-1,5-diene-1-carboxylic acid (PubChem CID 150890312) has the molecular formula C15H16O2 and a molecular weight of 228.29 g/mol. Its IUPAC name is 3,3-dimethyl-2-phenylcyclohexa-1,5-diene-1-carboxylic acid.
| Compound Name | 3,3-dimethyl-2-phenylcyclohexa-1,5-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 150890312 |
| Molecular Formula | C15H16O2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 3,3-dimethyl-2-phenylcyclohexa-1,5-diene-1-carboxylic acid |
| SMILES | CC1(C)CC=CC(C(=O)O)=C1c1ccccc1 |
| InChI | InChI=1S/C15H16O2/c1-15(2)10-6-9-12(14(16)17)13(15)11-7-4-3-5-8-11/h3-9H,10H2,1-2H3,(H,16,17) |
| InChIKey | KXWQXAXOTDLDRB-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |