C15H24 — CID 153389837
1,2,4,5-tetraethylcyclohepta-1,3,5-triene (PubChem CID 153389837) has the molecular formula C15H24 and a molecular weight of 204.36 g/mol. Its IUPAC name is 1,2,4,5-tetraethylcyclohepta-1,3,5-triene.
| Compound Name | 1,2,4,5-tetraethylcyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 153389837 |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.19 |
| IUPAC Name | 1,2,4,5-tetraethylcyclohepta-1,3,5-triene |
| SMILES | CCC1=CCC(CC)=C(CC)C=C1CC |
| InChI | InChI=1S/C15H24/c1-5-12-9-10-13(6-2)15(8-4)11-14(12)7-3/h9,11H,5-8,10H2,1-4H3 |
| InChIKey | BILJYMFXHINVCZ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |