C10H17NO2 — CID 165130299
3,4-diethoxycyclohexa-1,3-dien-1-amine (PubChem CID 165130299) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is 3,4-diethoxycyclohexa-1,3-dien-1-amine.
| Compound Name | 3,4-diethoxycyclohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 165130299 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 3,4-diethoxycyclohexa-1,3-dien-1-amine |
| SMILES | CCOC1=C(OCC)CCC(N)=C1 |
| InChI | InChI=1S/C10H17NO2/c1-3-12-9-6-5-8(11)7-10(9)13-4-2/h7H,3-6,11H2,1-2H3 |
| InChIKey | PJAAGLLFRLGGTC-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |