C10H16O — CID 142132328
2-ethoxy-1,4-dimethylcyclohexa-1,3-diene (PubChem CID 142132328) has the molecular formula C10H16O and a molecular weight of 152.24 g/mol. Its IUPAC name is 2-ethoxy-1,4-dimethylcyclohexa-1,3-diene.
| Compound Name | 2-ethoxy-1,4-dimethylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 142132328 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | 2-ethoxy-1,4-dimethylcyclohexa-1,3-diene |
| SMILES | CCOC1=C(C)CCC(C)=C1 |
| InChI | InChI=1S/C10H16O/c1-4-11-10-7-8(2)5-6-9(10)3/h7H,4-6H2,1-3H3 |
| InChIKey | JRQSKDVJPDGEET-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |