C13H20O2 — CID 143806825
2-[(E)-4-ethoxybut-2-enoxy]-1-methylcyclohexa-1,3-diene (PubChem CID 143806825) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is 2-[(E)-4-ethoxybut-2-enoxy]-1-methylcyclohexa-1,3-diene.
| Compound Name | 2-[(E)-4-ethoxybut-2-enoxy]-1-methylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 143806825 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 2-[(E)-4-ethoxybut-2-enoxy]-1-methylcyclohexa-1,3-diene |
| SMILES | CCOC/C=C/COC1=C(C)CCC=C1 |
| InChI | InChI=1S/C13H20O2/c1-3-14-10-6-7-11-15-13-9-5-4-8-12(13)2/h5-7,9H,3-4,8,10-11H2,1-2H3/b7-6+ |
| InChIKey | UJPJCTSWDSHAPF-VOTSOKGWSA-N |
| XLogP | 3.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|