C12H22O — CID 144678708
ethane;1-methyl-2-propoxycyclohexa-1,3-diene (PubChem CID 144678708) has the molecular formula C12H22O and a molecular weight of 182.31 g/mol. Its IUPAC name is ethane;1-methyl-2-propoxycyclohexa-1,3-diene.
| Compound Name | ethane;1-methyl-2-propoxycyclohexa-1,3-diene |
|---|---|
| PubChem CID | 144678708 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | ethane;1-methyl-2-propoxycyclohexa-1,3-diene |
| SMILES | CC.CCCOC1=C(C)CCC=C1 |
| InChI | InChI=1S/C10H16O.C2H6/c1-3-8-11-10-7-5-4-6-9(10)2;1-2/h5,7H,3-4,6,8H2,1-2H3;1-2H3 |
| InChIKey | HIPCOKWXBRHQMB-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |