C12H20N2O — CID 71188495
2-(2-pyrrolidin-1-ylethoxy)cyclohexa-1,3-dien-1-amine (PubChem CID 71188495) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is 2-(2-pyrrolidin-1-ylethoxy)cyclohexa-1,3-dien-1-amine.
| Compound Name | 2-(2-pyrrolidin-1-ylethoxy)cyclohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 71188495 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 2-(2-pyrrolidin-1-ylethoxy)cyclohexa-1,3-dien-1-amine |
| SMILES | NC1=C(OCCN2CCCC2)C=CCC1 |
| InChI | InChI=1S/C12H20N2O/c13-11-5-1-2-6-12(11)15-10-9-14-7-3-4-8-14/h2,6H,1,3-5,7-10,13H2 |
| InChIKey | ICVMTZPSKAZXRW-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |