C8H14OSi — CID 174473655
(2-propoxycyclopenta-1,3-dien-1-yl)silane (PubChem CID 174473655) has the molecular formula C8H14OSi and a molecular weight of 154.28 g/mol. Its IUPAC name is (2-propoxycyclopenta-1,3-dien-1-yl)silane.
| Compound Name | (2-propoxycyclopenta-1,3-dien-1-yl)silane |
|---|---|
| PubChem CID | 174473655 |
| Molecular Formula | C8H14OSi |
| Molecular Weight | 154.28 g/mol |
| Exact Mass | 154.08 |
| IUPAC Name | (2-propoxycyclopenta-1,3-dien-1-yl)silane |
| SMILES | CCCOC1=C([SiH3])CC=C1 |
| InChI | InChI=1S/C8H14OSi/c1-2-6-9-7-4-3-5-8(7)10/h3-4H,2,5-6H2,1,10H3 |
| InChIKey | LXHBEMFPMJFSPR-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.28 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|