About CID 153352377
CID 153352377 (PubChem CID 153352377) has the molecular formula C14H17KNO
and a molecular weight of 254.39 g/mol.
Molecular Properties
| Compound Name | CID 153352377 |
| PubChem CID | 153352377 |
| Molecular Formula | C14H17KNO |
| Molecular Weight | 254.39 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | — |
| SMILES | CCCOc1cccc2c1N=C(C)C=CC2.[K] |
| InChI | InChI=1S/C14H17NO.K/c1-3-10-16-13-9-5-8-12-7-4-6-11(2)15-14(12)13;/h4-6,8-9H,3,7,10H2,1-2H3; |
| InChIKey | RTWRBCHIRIJSFT-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.39 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 153352377 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 153352377?
The IUPAC name of CID 153352377 (CID 153352377) is not available.
What is the SMILES notation for CID 153352377?
The canonical SMILES for CID 153352377 is CCCOc1cccc2c1N=C(C)C=CC2.[K].
What is the InChIKey of CID 153352377?
The InChIKey is RTWRBCHIRIJSFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO.K/c1-3-10-16-13-9-5-8-12-7-4-6-11(2)15-14(12)13;/h4-6,8-9H,3,7,10H2,1-2H3;.
What are the key properties of CID 153352377?
CID 153352377 has a molecular weight of 254.39 g/mol, XLogP of 3.30, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 153352377 is sourced from PubChem (CID 153352377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).