C8H9NO — CID 163462349
2-isocyanato-1-methylcyclohexa-1,3-diene (PubChem CID 163462349) has the molecular formula C8H9NO and a molecular weight of 135.17 g/mol. Its IUPAC name is 2-isocyanato-1-methylcyclohexa-1,3-diene.
| Compound Name | 2-isocyanato-1-methylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 163462349 |
| Molecular Formula | C8H9NO |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.07 |
| IUPAC Name | 2-isocyanato-1-methylcyclohexa-1,3-diene |
| SMILES | CC1=C(N=C=O)C=CCC1 |
| InChI | InChI=1S/C8H9NO/c1-7-4-2-3-5-8(7)9-6-10/h3,5H,2,4H2,1H3 |
| InChIKey | BPRHJHTUCYILPW-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|