C11H10N2O2 — CID 142914069
5-cyclohexa-1,5-dien-1-yl-4-isocyanato-3-methyl-1,2-oxazole (PubChem CID 142914069) has the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. Its IUPAC name is 5-cyclohexa-1,5-dien-1-yl-4-isocyanato-3-methyl-1,2-oxazole.
| Compound Name | 5-cyclohexa-1,5-dien-1-yl-4-isocyanato-3-methyl-1,2-oxazole |
|---|---|
| PubChem CID | 142914069 |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 5-cyclohexa-1,5-dien-1-yl-4-isocyanato-3-methyl-1,2-oxazole |
| SMILES | Cc1noc(C2=CCCC=C2)c1N=C=O |
| InChI | InChI=1S/C11H10N2O2/c1-8-10(12-7-14)11(15-13-8)9-5-3-2-4-6-9/h3,5-6H,2,4H2,1H3 |
| InChIKey | KHDCAUPGPWWTHE-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 55.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|