C14H11NO — CID 163957293
9-isocyanato-2,9-dihydro-1H-fluorene (PubChem CID 163957293) has the molecular formula C14H11NO and a molecular weight of 209.25 g/mol. Its IUPAC name is 9-isocyanato-2,9-dihydro-1H-fluorene.
| Compound Name | 9-isocyanato-2,9-dihydro-1H-fluorene |
|---|---|
| PubChem CID | 163957293 |
| Molecular Formula | C14H11NO |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | 9-isocyanato-2,9-dihydro-1H-fluorene |
| SMILES | O=C=NC1C2=C(C=CCC2)c2ccccc21 |
| InChI | InChI=1S/C14H11NO/c16-9-15-14-12-7-3-1-5-10(12)11-6-2-4-8-13(11)14/h1-3,5-7,14H,4,8H2 |
| InChIKey | SEMFCMQWEQPDDX-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|