C18H16S — CID 170288323
2-(2-phenylcyclohexa-1,5-dien-1-yl)benzenethiol (PubChem CID 170288323) has the molecular formula C18H16S and a molecular weight of 264.39 g/mol. Its IUPAC name is 2-(2-phenylcyclohexa-1,5-dien-1-yl)benzenethiol.
| Compound Name | 2-(2-phenylcyclohexa-1,5-dien-1-yl)benzenethiol |
|---|---|
| PubChem CID | 170288323 |
| Molecular Formula | C18H16S |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 2-(2-phenylcyclohexa-1,5-dien-1-yl)benzenethiol |
| SMILES | Sc1ccccc1C1=C(c2ccccc2)CCC=C1 |
| InChI | InChI=1S/C18H16S/c19-18-13-7-6-12-17(18)16-11-5-4-10-15(16)14-8-2-1-3-9-14/h1-3,5-9,11-13,19H,4,10H2 |
| InChIKey | OATWIWPNAJHTCG-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|