C17H26N2 — CID 143038930
2,9-dihydro-1H-fluoren-9-amine;methane;propan-2-amine (PubChem CID 143038930) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is 2,9-dihydro-1H-fluoren-9-amine;methane;propan-2-amine.
| Compound Name | 2,9-dihydro-1H-fluoren-9-amine;methane;propan-2-amine |
|---|---|
| PubChem CID | 143038930 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | 2,9-dihydro-1H-fluoren-9-amine;methane;propan-2-amine |
| SMILES | C.CC(C)N.NC1C2=C(C=CCC2)c2ccccc21 |
| InChI | InChI=1S/C13H13N.C3H9N.CH4/c14-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13;1-3(2)4;/h1-3,5-7,13H,4,8,14H2;3H,4H2,1-2H3;1H4 |
| InChIKey | NYYLPELGEKOACW-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |