C16H18 — CID 144613246
7,10-dimethyl-1,2,9,10-tetrahydrophenanthrene (PubChem CID 144613246) has the molecular formula C16H18 and a molecular weight of 210.32 g/mol. Its IUPAC name is 7,10-dimethyl-1,2,9,10-tetrahydrophenanthrene.
| Compound Name | 7,10-dimethyl-1,2,9,10-tetrahydrophenanthrene |
|---|---|
| PubChem CID | 144613246 |
| Molecular Formula | C16H18 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 7,10-dimethyl-1,2,9,10-tetrahydrophenanthrene |
| SMILES | Cc1ccc2c(c1)CC(C)C1=C2C=CCC1 |
| InChI | InChI=1S/C16H18/c1-11-7-8-15-13(9-11)10-12(2)14-5-3-4-6-16(14)15/h4,6-9,12H,3,5,10H2,1-2H3 |
| InChIKey | VZDZDJJPKSVTSQ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |