About 1,4-dimethyl-2-(2-methylcyclohexa-1,5-dien-1-yl)benzene
1,4-dimethyl-2-(2-methylcyclohexa-1,5-dien-1-yl)benzene (PubChem CID 144508719) has the molecular formula C15H18
and a molecular weight of 198.31 g/mol. Its IUPAC name is 1,4-dimethyl-2-(2-methylcyclohexa-1,5-dien-1-yl)benzene.
Molecular Properties
| Compound Name | 1,4-dimethyl-2-(2-methylcyclohexa-1,5-dien-1-yl)benzene |
| PubChem CID | 144508719 |
| Molecular Formula | C15H18 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 1,4-dimethyl-2-(2-methylcyclohexa-1,5-dien-1-yl)benzene |
| SMILES | CC1=C(c2cc(C)ccc2C)C=CCC1 |
| InChI | InChI=1S/C15H18/c1-11-8-9-13(3)15(10-11)14-7-5-4-6-12(14)2/h5,7-10H,4,6H2,1-3H3 |
| InChIKey | GWOPZFUCSAHTGI-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,4-dimethyl-2-(2-methylcyclohexa-1,5-dien-1-yl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dimethyl-2-(2-methylcyclohexa-1,5-dien-1-yl)benzene?
The IUPAC name of 1,4-dimethyl-2-(2-methylcyclohexa-1,5-dien-1-yl)benzene (CID 144508719) is 1,4-dimethyl-2-(2-methylcyclohexa-1,5-dien-1-yl)benzene.
What is the SMILES notation for 1,4-dimethyl-2-(2-methylcyclohexa-1,5-dien-1-yl)benzene?
The canonical SMILES for 1,4-dimethyl-2-(2-methylcyclohexa-1,5-dien-1-yl)benzene is CC1=C(c2cc(C)ccc2C)C=CCC1.
What is the InChIKey of 1,4-dimethyl-2-(2-methylcyclohexa-1,5-dien-1-yl)benzene?
The InChIKey is GWOPZFUCSAHTGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18/c1-11-8-9-13(3)15(10-11)14-7-5-4-6-12(14)2/h5,7-10H,4,6H2,1-3H3.
What are the key properties of 1,4-dimethyl-2-(2-methylcyclohexa-1,5-dien-1-yl)benzene?
1,4-dimethyl-2-(2-methylcyclohexa-1,5-dien-1-yl)benzene has a molecular weight of 198.31 g/mol, XLogP of 4.43, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethyl-2-(2-methylcyclohexa-1,5-dien-1-yl)benzene is sourced from PubChem (CID 144508719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).