C16H18 — CID 144639578
6,9,9-trimethyl-3,4-dihydrofluorene (PubChem CID 144639578) has the molecular formula C16H18 and a molecular weight of 210.32 g/mol. Its IUPAC name is 6,9,9-trimethyl-3,4-dihydrofluorene.
| Compound Name | 6,9,9-trimethyl-3,4-dihydrofluorene |
|---|---|
| PubChem CID | 144639578 |
| Molecular Formula | C16H18 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 6,9,9-trimethyl-3,4-dihydrofluorene |
| SMILES | Cc1ccc2c(c1)C1=C(C=CCC1)C2(C)C |
| InChI | InChI=1S/C16H18/c1-11-8-9-15-13(10-11)12-6-4-5-7-14(12)16(15,2)3/h5,7-10H,4,6H2,1-3H3 |
| InChIKey | OZGHMUICARRSDG-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |