C54H46N2 — CID 71016755
5-(9,9-dimethyl-5,6-dihydrofluoren-2-yl)-1-(9,9-dimethylfluoren-2-yl)-2,6-bis(4-methylphenyl)pyrrolo[2,3-f]indole (PubChem CID 71016755) has the molecular formula C54H46N2 and a molecular weight of 722.98 g/mol. Its IUPAC name is 5-(9,9-dimethyl-5,6-dihydrofluoren-2-yl)-1-(9,9-dimethylfluoren-2-yl)-2,6-bis(4-methylphenyl)pyrrolo[2,3-f]indole.
| Compound Name | 5-(9,9-dimethyl-5,6-dihydrofluoren-2-yl)-1-(9,9-dimethylfluoren-2-yl)-2,6-bis(4-methylphenyl)pyrrolo[2,3-f]indole |
|---|---|
| PubChem CID | 71016755 |
| Molecular Formula | C54H46N2 |
| Molecular Weight | 722.98 g/mol |
| Exact Mass | 722.37 |
| IUPAC Name | 5-(9,9-dimethyl-5,6-dihydrofluoren-2-yl)-1-(9,9-dimethylfluoren-2-yl)-2,6-bis(4-methylphenyl)pyrrolo[2,3-f]indole |
| SMILES | Cc1ccc(-c2cc3cc4c(cc(-c5ccc(C)cc5)n4-c4ccc5c(c4)C(C)(C)c4ccccc4-5)cc3n2-c2ccc3c(c2)C(C)(C)C2=C3CCC=C2)cc1 |
| InChI | InChI=1S/C54H46N2/c1-33-15-19-35(20-16-33)49-27-37-29-52-38(30-51(37)55(49)39-23-25-43-41-11-7-9-13-45(41)53(3,4)47(43)31-39)28-50(36-21-17-34(2)18-22-36)56(52)40-24-26-44-42-12-8-10-14-46(42)54(5,6)48(44)32-40/h7,9-11,13-32H,8,12H2,1-6H3 |
| InChIKey | MHGHJTUOOCFKNN-UHFFFAOYSA-N |
| XLogP | 14.23 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.98 |
| LogP ≤ 5 | 14.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |