C55H43N3 — CID 145377613
2-[3-(9,9-dimethyl-5,6-dihydrofluoren-3-yl)-5-(9,9-dimethylfluoren-3-yl)phenyl]-4-naphthalen-2-yl-6-phenyl-1,3,5-triazine (PubChem CID 145377613) has the molecular formula C55H43N3 and a molecular weight of 745.97 g/mol. Its IUPAC name is 2-[3-(9,9-dimethyl-5,6-dihydrofluoren-3-yl)-5-(9,9-dimethylfluoren-3-yl)phenyl]-4-naphthalen-2-yl-6-phenyl-1,3,5-triazine.
| Compound Name | 2-[3-(9,9-dimethyl-5,6-dihydrofluoren-3-yl)-5-(9,9-dimethylfluoren-3-yl)phenyl]-4-naphthalen-2-yl-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 145377613 |
| Molecular Formula | C55H43N3 |
| Molecular Weight | 745.97 g/mol |
| Exact Mass | 745.35 |
| IUPAC Name | 2-[3-(9,9-dimethyl-5,6-dihydrofluoren-3-yl)-5-(9,9-dimethylfluoren-3-yl)phenyl]-4-naphthalen-2-yl-6-phenyl-1,3,5-triazine |
| SMILES | CC1(C)C2=C(CCC=C2)c2cc(-c3cc(-c4ccc5c(c4)-c4ccccc4C5(C)C)cc(-c4nc(-c5ccccc5)nc(-c5ccc6ccccc6c5)n4)c3)ccc21 |
| InChI | InChI=1S/C55H43N3/c1-54(2)47-20-12-10-18-43(47)45-32-37(24-26-49(45)54)40-29-41(38-25-27-50-46(33-38)44-19-11-13-21-48(44)55(50,3)4)31-42(30-40)53-57-51(35-15-6-5-7-16-35)56-52(58-53)39-23-22-34-14-8-9-17-36(34)28-39/h5-10,12-18,20-33H,11,19H2,1-4H3 |
| InChIKey | KAJJOZMIUIAQMS-UHFFFAOYSA-N |
| XLogP | 14.06 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.97 |
| LogP ≤ 5 | 14.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |