C30H34 — CID 123554615
2-(9,9-dimethyl-3,4,5,6-tetrahydrofluoren-2-yl)-9,9-dimethyl-3,4,5,6-tetrahydrofluorene (PubChem CID 123554615) has the molecular formula C30H34 and a molecular weight of 394.60 g/mol. Its IUPAC name is 2-(9,9-dimethyl-3,4,5,6-tetrahydrofluoren-2-yl)-9,9-dimethyl-3,4,5,6-tetrahydrofluorene.
| Compound Name | 2-(9,9-dimethyl-3,4,5,6-tetrahydrofluoren-2-yl)-9,9-dimethyl-3,4,5,6-tetrahydrofluorene |
|---|---|
| PubChem CID | 123554615 |
| Molecular Formula | C30H34 |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | 2-(9,9-dimethyl-3,4,5,6-tetrahydrofluoren-2-yl)-9,9-dimethyl-3,4,5,6-tetrahydrofluorene |
| SMILES | CC1(C)C2=C(CCC=C2)C2=C1C=C(C1=CC3=C(CC1)C1=C(C=CCC1)C3(C)C)CC2 |
| InChI | InChI=1S/C30H34/c1-29(2)25-11-7-5-9-21(25)23-15-13-19(17-27(23)29)20-14-16-24-22-10-6-8-12-26(22)30(3,4)28(24)18-20/h7-8,11-12,17-18H,5-6,9-10,13-16H2,1-4H3 |
| InChIKey | NDRSEWBVQGWTCK-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |