C46H46 — CID 123504405
8-[7-(9,9-dimethyl-3,4,5,6-tetrahydrofluoren-2-yl)-9,9-dimethyl-3,4,5,6-tetrahydrofluoren-2-yl]-1,2,10,10a-tetrahydropyrene (PubChem CID 123504405) has the molecular formula C46H46 and a molecular weight of 598.87 g/mol. Its IUPAC name is 8-[7-(9,9-dimethyl-3,4,5,6-tetrahydrofluoren-2-yl)-9,9-dimethyl-3,4,5,6-tetrahydrofluoren-2-yl]-1,2,10,10a-tetrahydropyrene.
| Compound Name | 8-[7-(9,9-dimethyl-3,4,5,6-tetrahydrofluoren-2-yl)-9,9-dimethyl-3,4,5,6-tetrahydrofluoren-2-yl]-1,2,10,10a-tetrahydropyrene |
|---|---|
| PubChem CID | 123504405 |
| Molecular Formula | C46H46 |
| Molecular Weight | 598.87 g/mol |
| Exact Mass | 598.36 |
| IUPAC Name | 8-[7-(9,9-dimethyl-3,4,5,6-tetrahydrofluoren-2-yl)-9,9-dimethyl-3,4,5,6-tetrahydrofluoren-2-yl]-1,2,10,10a-tetrahydropyrene |
| SMILES | CC1(C)C2=C(CCC=C2)C2=C1C=C(C1=CC3=C(CC1)C1=C(C=C(c4ccc5ccc6c7c5c4=CCC7CCC=6)CC1)C3(C)C)CC2 |
| InChI | InChI=1S/C46H46/c1-45(2)39-11-6-5-10-34(39)35-20-16-30(24-40(35)45)31-17-21-36-37-22-18-32(26-42(37)46(3,4)41(36)25-31)33-19-14-29-13-12-27-8-7-9-28-15-23-38(33)44(29)43(27)28/h6,8,11-14,19,23-26,28H,5,7,9-10,15-18,20-22H2,1-4H3 |
| InChIKey | BPMLINOJJZDVND-UHFFFAOYSA-N |
| XLogP | 10.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.87 |
| LogP ≤ 5 | 10.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |