C49H57N — CID 170445127
9,9-dimethyl-N-phenyl-N,3-bis(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-5,6-dihydrofluoren-2-amine (PubChem CID 170445127) has the molecular formula C49H57N and a molecular weight of 660.00 g/mol. Its IUPAC name is 9,9-dimethyl-N-phenyl-N,3-bis(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-5,6-dihydrofluoren-2-amine.
| Compound Name | 9,9-dimethyl-N-phenyl-N,3-bis(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-5,6-dihydrofluoren-2-amine |
|---|---|
| PubChem CID | 170445127 |
| Molecular Formula | C49H57N |
| Molecular Weight | 660.00 g/mol |
| Exact Mass | 659.45 |
| IUPAC Name | 9,9-dimethyl-N-phenyl-N,3-bis(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-5,6-dihydrofluoren-2-amine |
| SMILES | CC1(C)CCC(C)(C)c2cc(-c3cc4c(cc3N(c3ccccc3)c3ccc5c(c3)C(C)(C)CCC5(C)C)C(C)(C)C3=C4CCC=C3)ccc21 |
| InChI | InChI=1S/C49H57N/c1-45(2)24-26-47(5,6)42-28-32(20-22-39(42)45)36-30-37-35-18-14-15-19-38(35)49(9,10)41(37)31-44(36)50(33-16-12-11-13-17-33)34-21-23-40-43(29-34)48(7,8)27-25-46(40,3)4/h11-13,15-17,19-23,28-31H,14,18,24-27H2,1-10H3 |
| InChIKey | ZPEJRJFEEYOGTI-UHFFFAOYSA-N |
| XLogP | 13.92 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.00 |
| LogP ≤ 5 | 13.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |