C15H17N3 — CID 142938749
N-imino-4-methyl-3-(2-methylcyclohexa-1,5-dien-1-yl)benzenecarboximidamide (PubChem CID 142938749) has the molecular formula C15H17N3 and a molecular weight of 239.32 g/mol. Its IUPAC name is N-imino-4-methyl-3-(2-methylcyclohexa-1,5-dien-1-yl)benzenecarboximidamide.
| Compound Name | N-imino-4-methyl-3-(2-methylcyclohexa-1,5-dien-1-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 142938749 |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | N-imino-4-methyl-3-(2-methylcyclohexa-1,5-dien-1-yl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N=N\[H])c1ccc(C)c(C2=C(C)CCC=C2)c1 |
| InChI | InChI=1S/C15H17N3/c1-10-5-3-4-6-13(10)14-9-12(15(16)18-17)8-7-11(14)2/h4,6-9,16-17H,3,5H2,1-2H3/b16-15-,18-17+ |
| InChIKey | JXHNTVFLHIKKRW-LZFZKRRQSA-N |
| XLogP | 4.47 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|