C25H30N4O — CID 143165766
acetylene;N-imino-5-[(E)-2-methylbut-2-enyl]-6H-phenanthridine-2-carboximidamide;3-methoxyprop-1-ene (PubChem CID 143165766) has the molecular formula C25H30N4O and a molecular weight of 402.54 g/mol. Its IUPAC name is acetylene;N-imino-5-[(E)-2-methylbut-2-enyl]-6H-phenanthridine-2-carboximidamide;3-methoxyprop-1-ene.
| Compound Name | acetylene;N-imino-5-[(E)-2-methylbut-2-enyl]-6H-phenanthridine-2-carboximidamide;3-methoxyprop-1-ene |
|---|---|
| PubChem CID | 143165766 |
| Molecular Formula | C25H30N4O |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | acetylene;N-imino-5-[(E)-2-methylbut-2-enyl]-6H-phenanthridine-2-carboximidamide;3-methoxyprop-1-ene |
| SMILES | C#C.C=CCOC.[H]/N=C(\N=N\[H])c1ccc2c(c1)-c1ccccc1CN2C/C(C)=C/C |
| InChI | InChI=1S/C19H20N4.C4H8O.C2H2/c1-3-13(2)11-23-12-15-6-4-5-7-16(15)17-10-14(19(20)22-21)8-9-18(17)23;1-3-4-5-2;1-2/h3-10,20-21H,11-12H2,1-2H3;3H,1,4H2,2H3;1-2H/b13-3+,20-19-,22-21+;; |
| InChIKey | MMAIYRUDDHJGIS-QJAYFGCNSA-N |
| XLogP | 6.06 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|