About (propan-2-ylideneamino) 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate
(propan-2-ylideneamino) 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate (PubChem CID 88611551) has the molecular formula C18H19N3O
and a molecular weight of 293.37 g/mol. Its IUPAC name is (propan-2-ylideneamino) 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate.
Molecular Properties
| Compound Name | (propan-2-ylideneamino) 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate |
| PubChem CID | 88611551 |
| Molecular Formula | C18H19N3O |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | (propan-2-ylideneamino) 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate |
| SMILES | [H]/N=C(\ON=C(C)C)N1Cc2ccccc2-c2ccccc2C1 |
| InChI | InChI=1S/C18H19N3O/c1-13(2)20-22-18(19)21-11-14-7-3-5-9-16(14)17-10-6-4-8-15(17)12-21/h3-10,19H,11-12H2,1-2H3/b19-18- |
| InChIKey | NARLQNLLIKDYRT-HNENSFHCSA-N |
| XLogP | 4.02 |
| TPSA | 48.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (propan-2-ylideneamino) 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (propan-2-ylideneamino) 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate?
The IUPAC name of (propan-2-ylideneamino) 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate (CID 88611551) is (propan-2-ylideneamino) 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate.
What is the SMILES notation for (propan-2-ylideneamino) 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate?
The canonical SMILES for (propan-2-ylideneamino) 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate is [H]/N=C(\ON=C(C)C)N1Cc2ccccc2-c2ccccc2C1.
What is the InChIKey of (propan-2-ylideneamino) 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate?
The InChIKey is NARLQNLLIKDYRT-HNENSFHCSA-N. The full InChI is InChI=1S/C18H19N3O/c1-13(2)20-22-18(19)21-11-14-7-3-5-9-16(14)17-10-6-4-8-15(17)12-21/h3-10,19H,11-12H2,1-2H3/b19-18-.
What are the key properties of (propan-2-ylideneamino) 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate?
(propan-2-ylideneamino) 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate has a molecular weight of 293.37 g/mol, XLogP of 4.02, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (propan-2-ylideneamino) 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate is sourced from PubChem (CID 88611551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).