C10H12N2O — CID 119090044
methyl 1,3-dihydroisoindole-2-carboximidate (PubChem CID 119090044) has the molecular formula C10H12N2O and a molecular weight of 176.22 g/mol. Its IUPAC name is methyl 1,3-dihydroisoindole-2-carboximidate.
| Compound Name | methyl 1,3-dihydroisoindole-2-carboximidate |
|---|---|
| PubChem CID | 119090044 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | methyl 1,3-dihydroisoindole-2-carboximidate |
| SMILES | [H]/N=C(\OC)N1Cc2ccccc2C1 |
| InChI | InChI=1S/C10H12N2O/c1-13-10(11)12-6-8-4-2-3-5-9(8)7-12/h2-5,11H,6-7H2,1H3/b11-10- |
| InChIKey | GTKDWXGHJKFDDZ-KHPPLWFESA-N |
| XLogP | 1.58 |
| TPSA | 36.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|