About benzyl 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate;hydrochloride
benzyl 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate;hydrochloride (PubChem CID 19833991) has the molecular formula C22H21ClN2O
and a molecular weight of 364.88 g/mol. Its IUPAC name is benzyl 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate;hydrochloride.
Molecular Properties
| Compound Name | benzyl 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate;hydrochloride |
| PubChem CID | 19833991 |
| Molecular Formula | C22H21ClN2O |
| Molecular Weight | 364.88 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | benzyl 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate;hydrochloride |
| SMILES | Cl.[H]/N=C(\OCc1ccccc1)N1Cc2ccccc2-c2ccccc2C1 |
| InChI | InChI=1S/C22H20N2O.ClH/c23-22(25-16-17-8-2-1-3-9-17)24-14-18-10-4-6-12-20(18)21-13-7-5-11-19(21)15-24;/h1-13,23H,14-16H2;1H/b23-22-; |
| InChIKey | LPWUNCISHVKKBY-YJACDMIVSA-N |
| XLogP | 5.24 |
| TPSA | 36.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.88 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze benzyl 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate;hydrochloride?
The IUPAC name of benzyl 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate;hydrochloride (CID 19833991) is benzyl 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate;hydrochloride.
What is the SMILES notation for benzyl 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate;hydrochloride?
The canonical SMILES for benzyl 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate;hydrochloride is Cl.[H]/N=C(\OCc1ccccc1)N1Cc2ccccc2-c2ccccc2C1.
What is the InChIKey of benzyl 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate;hydrochloride?
The InChIKey is LPWUNCISHVKKBY-YJACDMIVSA-N. The full InChI is InChI=1S/C22H20N2O.ClH/c23-22(25-16-17-8-2-1-3-9-17)24-14-18-10-4-6-12-20(18)21-13-7-5-11-19(21)15-24;/h1-13,23H,14-16H2;1H/b23-22-;.
What are the key properties of benzyl 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate;hydrochloride?
benzyl 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate;hydrochloride has a molecular weight of 364.88 g/mol, XLogP of 5.24, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate;hydrochloride is sourced from PubChem (CID 19833991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).