C22H21ClN2O — CID 19833991
benzyl 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate;hydrochloride (PubChem CID 19833991) has the molecular formula C22H21ClN2O and a molecular weight of 364.88 g/mol. Its IUPAC name is benzyl 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate;hydrochloride.
| Compound Name | benzyl 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate;hydrochloride |
|---|---|
| PubChem CID | 19833991 |
| Molecular Formula | C22H21ClN2O |
| Molecular Weight | 364.88 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | benzyl 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate;hydrochloride |
| SMILES | Cl.[H]/N=C(\OCc1ccccc1)N1Cc2ccccc2-c2ccccc2C1 |
| InChI | InChI=1S/C22H20N2O.ClH/c23-22(25-16-17-8-2-1-3-9-17)24-14-18-10-4-6-12-20(18)21-13-7-5-11-19(21)15-24;/h1-13,23H,14-16H2;1H/b23-22-; |
| InChIKey | LPWUNCISHVKKBY-YJACDMIVSA-N |
| XLogP | 5.24 |
| TPSA | 36.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.88 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|