C11H14N2 — CID 63176539
1-(1,3-dihydroisoindol-2-yl)propan-1-imine (PubChem CID 63176539) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 1-(1,3-dihydroisoindol-2-yl)propan-1-imine.
| Compound Name | 1-(1,3-dihydroisoindol-2-yl)propan-1-imine |
|---|---|
| PubChem CID | 63176539 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 1-(1,3-dihydroisoindol-2-yl)propan-1-imine |
| SMILES | [H]/N=C(\CC)N1Cc2ccccc2C1 |
| InChI | InChI=1S/C11H14N2/c1-2-11(12)13-7-9-5-3-4-6-10(9)8-13/h3-6,12H,2,7-8H2,1H3/b12-11+ |
| InChIKey | HTDRLQHQJNLLFC-VAWYXSNFSA-N |
| XLogP | 2.39 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|