C15H22N2 — CID 63181790
2,2-dimethyl-1-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)propan-1-imine (PubChem CID 63181790) has the molecular formula C15H22N2 and a molecular weight of 230.36 g/mol. Its IUPAC name is 2,2-dimethyl-1-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)propan-1-imine.
| Compound Name | 2,2-dimethyl-1-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)propan-1-imine |
|---|---|
| PubChem CID | 63181790 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 2,2-dimethyl-1-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)propan-1-imine |
| SMILES | [H]/N=C(/N1CCCc2ccccc2C1)C(C)(C)C |
| InChI | InChI=1S/C15H22N2/c1-15(2,3)14(16)17-10-6-9-12-7-4-5-8-13(12)11-17/h4-5,7-8,16H,6,9-11H2,1-3H3/b16-14+ |
| InChIKey | HDXNOXXAFDPHBG-JQIJEIRASA-N |
| XLogP | 3.46 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|