C13H18N2 — CID 63181730
1-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)propan-1-imine (PubChem CID 63181730) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 1-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)propan-1-imine.
| Compound Name | 1-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)propan-1-imine |
|---|---|
| PubChem CID | 63181730 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 1-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)propan-1-imine |
| SMILES | [H]/N=C(\CC)N1CCCc2ccccc2C1 |
| InChI | InChI=1S/C13H18N2/c1-2-13(14)15-9-5-8-11-6-3-4-7-12(11)10-15/h3-4,6-7,14H,2,5,8-10H2,1H3/b14-13+ |
| InChIKey | XJNSDZZXHDZDTO-BUHFOSPRSA-N |
| XLogP | 2.82 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|