C10H12N2 — CID 63173351
1-(1,3-dihydroisoindol-2-yl)ethanimine (PubChem CID 63173351) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is 1-(1,3-dihydroisoindol-2-yl)ethanimine.
| Compound Name | 1-(1,3-dihydroisoindol-2-yl)ethanimine |
|---|---|
| PubChem CID | 63173351 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 1-(1,3-dihydroisoindol-2-yl)ethanimine |
| SMILES | [H]/N=C(\C)N1Cc2ccccc2C1 |
| InChI | InChI=1S/C10H12N2/c1-8(11)12-6-9-4-2-3-5-10(9)7-12/h2-5,11H,6-7H2,1H3/b11-8+ |
| InChIKey | FHFNOAPSZSEJMB-DHZHZOJOSA-N |
| XLogP | 2.00 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|