C21H18N2O — CID 19833954
phenyl 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate (PubChem CID 19833954) has the molecular formula C21H18N2O and a molecular weight of 314.39 g/mol. Its IUPAC name is phenyl 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate.
| Compound Name | phenyl 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate |
|---|---|
| PubChem CID | 19833954 |
| Molecular Formula | C21H18N2O |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | phenyl 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate |
| SMILES | [H]/N=C(/Oc1ccccc1)N1Cc2ccccc2-c2ccccc2C1 |
| InChI | InChI=1S/C21H18N2O/c22-21(24-18-10-2-1-3-11-18)23-14-16-8-4-6-12-19(16)20-13-7-5-9-17(20)15-23/h1-13,22H,14-15H2/b22-21+ |
| InChIKey | PVUVFRWUGDDEKI-QURGRASLSA-N |
| XLogP | 4.68 |
| TPSA | 36.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|