C24H31N3O2 — CID 19833905
2-[(Z)-heptan-3-ylideneamino]oxyethyl 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate (PubChem CID 19833905) has the molecular formula C24H31N3O2 and a molecular weight of 393.53 g/mol. Its IUPAC name is 2-[(Z)-heptan-3-ylideneamino]oxyethyl 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate.
| Compound Name | 2-[(Z)-heptan-3-ylideneamino]oxyethyl 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate |
|---|---|
| PubChem CID | 19833905 |
| Molecular Formula | C24H31N3O2 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | 2-[(Z)-heptan-3-ylideneamino]oxyethyl 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate |
| SMILES | [H]/N=C(\OCCO/N=C(/CC)CCCC)N1Cc2ccccc2-c2ccccc2C1 |
| InChI | InChI=1S/C24H31N3O2/c1-3-5-12-21(4-2)26-29-16-15-28-24(25)27-17-19-10-6-8-13-22(19)23-14-9-7-11-20(23)18-27/h6-11,13-14,25H,3-5,12,15-18H2,1-2H3/b25-24-,26-21- |
| InChIKey | GTTATIJPLFQNJI-JVNGIKHNSA-N |
| XLogP | 5.59 |
| TPSA | 57.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|