C23H27N3O2 — CID 19833970
2-(cyclohexylideneamino)oxyethyl 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate (PubChem CID 19833970) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 2-(cyclohexylideneamino)oxyethyl 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate.
| Compound Name | 2-(cyclohexylideneamino)oxyethyl 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate |
|---|---|
| PubChem CID | 19833970 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 2-(cyclohexylideneamino)oxyethyl 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate |
| SMILES | [H]/N=C(\OCCON=C1CCCCC1)N1Cc2ccccc2-c2ccccc2C1 |
| InChI | InChI=1S/C23H27N3O2/c24-23(27-14-15-28-25-20-10-2-1-3-11-20)26-16-18-8-4-6-12-21(18)22-13-7-5-9-19(22)17-26/h4-9,12-13,24H,1-3,10-11,14-17H2/b24-23- |
| InChIKey | BTPAOVZNBBZSFQ-VHXPQNKSSA-N |
| XLogP | 4.96 |
| TPSA | 57.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|