C20H22N2O2 — CID 70367334
oxolan-2-ylmethyl 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate (PubChem CID 70367334) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is oxolan-2-ylmethyl 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate.
| Compound Name | oxolan-2-ylmethyl 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate |
|---|---|
| PubChem CID | 70367334 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | oxolan-2-ylmethyl 5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate |
| SMILES | [H]/N=C(\OCC1CCCO1)N1Cc2ccccc2-c2ccccc2C1 |
| InChI | InChI=1S/C20H22N2O2/c21-20(24-14-17-8-5-11-23-17)22-12-15-6-1-3-9-18(15)19-10-4-2-7-16(19)13-22/h1-4,6-7,9-10,17,21H,5,8,11-14H2/b21-20- |
| InChIKey | RULJJTCHHSYUNS-MRCUWXFGSA-N |
| XLogP | 3.80 |
| TPSA | 45.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|