C21H23NO5S — CID 24518652
oxolan-2-ylmethyl 4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)benzoate (PubChem CID 24518652) has the molecular formula C21H23NO5S and a molecular weight of 401.48 g/mol. Its IUPAC name is oxolan-2-ylmethyl 4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)benzoate.
| Compound Name | oxolan-2-ylmethyl 4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)benzoate |
|---|---|
| PubChem CID | 24518652 |
| Molecular Formula | C21H23NO5S |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | oxolan-2-ylmethyl 4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)benzoate |
| SMILES | O=C(OCC1CCCO1)c1ccc(S(=O)(=O)N2CCc3ccccc3C2)cc1 |
| InChI | InChI=1S/C21H23NO5S/c23-21(27-15-19-6-3-13-26-19)17-7-9-20(10-8-17)28(24,25)22-12-11-16-4-1-2-5-18(16)14-22/h1-2,4-5,7-10,19H,3,6,11-15H2 |
| InChIKey | INLWWROURCDZJJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |