C14H18O3 — CID 91083290
1-[[(2S)-oxolan-2-yl]methoxy]-3,4-dihydro-1H-isochromene (PubChem CID 91083290) has the molecular formula C14H18O3 and a molecular weight of 234.30 g/mol. Its IUPAC name is 1-[[(2S)-oxolan-2-yl]methoxy]-3,4-dihydro-1H-isochromene.
| Compound Name | 1-[[(2S)-oxolan-2-yl]methoxy]-3,4-dihydro-1H-isochromene |
|---|---|
| PubChem CID | 91083290 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | 1-[[(2S)-oxolan-2-yl]methoxy]-3,4-dihydro-1H-isochromene |
| SMILES | c1ccc2c(c1)CCOC2OC[C@@H]1CCCO1 |
| InChI | InChI=1S/C14H18O3/c1-2-6-13-11(4-1)7-9-16-14(13)17-10-12-5-3-8-15-12/h1-2,4,6,12,14H,3,5,7-10H2/t12-,14?/m0/s1 |
| InChIKey | MILSTZFDDRSMHW-NBFOIZRFSA-N |
| XLogP | 2.45 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |