C15H19ClO — CID 55091627
2-[(1-chloro-1,2,3,4-tetrahydronaphthalen-2-yl)methyl]oxolane (PubChem CID 55091627) has the molecular formula C15H19ClO and a molecular weight of 250.77 g/mol. Its IUPAC name is 2-[(1-chloro-1,2,3,4-tetrahydronaphthalen-2-yl)methyl]oxolane.
| Compound Name | 2-[(1-chloro-1,2,3,4-tetrahydronaphthalen-2-yl)methyl]oxolane |
|---|---|
| PubChem CID | 55091627 |
| Molecular Formula | C15H19ClO |
| Molecular Weight | 250.77 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 2-[(1-chloro-1,2,3,4-tetrahydronaphthalen-2-yl)methyl]oxolane |
| SMILES | ClC1c2ccccc2CCC1CC1CCCO1 |
| InChI | InChI=1S/C15H19ClO/c16-15-12(10-13-5-3-9-17-13)8-7-11-4-1-2-6-14(11)15/h1-2,4,6,12-13,15H,3,5,7-10H2 |
| InChIKey | KIBBIVUFGFIUQE-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.77 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|