C14H15NO6S — CID 16619890
oxolan-2-ylmethyl 2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetate (PubChem CID 16619890) has the molecular formula C14H15NO6S and a molecular weight of 325.34 g/mol. Its IUPAC name is oxolan-2-ylmethyl 2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetate.
| Compound Name | oxolan-2-ylmethyl 2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetate |
|---|---|
| PubChem CID | 16619890 |
| Molecular Formula | C14H15NO6S |
| Molecular Weight | 325.34 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | oxolan-2-ylmethyl 2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetate |
| SMILES | O=C(CN1C(=O)c2ccccc2S1(=O)=O)OCC1CCCO1 |
| InChI | InChI=1S/C14H15NO6S/c16-13(21-9-10-4-3-7-20-10)8-15-14(17)11-5-1-2-6-12(11)22(15,18)19/h1-2,5-6,10H,3-4,7-9H2 |
| InChIKey | WCZNGHXNUPXWEJ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.34 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |