C23H23N3O4S2 — CID 24591731
1,1-dioxo-2-[2-[1-(oxolan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanylethyl]-1,2-benzothiazol-3-one (PubChem CID 24591731) has the molecular formula C23H23N3O4S2 and a molecular weight of 469.59 g/mol. Its IUPAC name is 1,1-dioxo-2-[2-[1-(oxolan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanylethyl]-1,2-benzothiazol-3-one.
| Compound Name | 1,1-dioxo-2-[2-[1-(oxolan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanylethyl]-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 24591731 |
| Molecular Formula | C23H23N3O4S2 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | 1,1-dioxo-2-[2-[1-(oxolan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanylethyl]-1,2-benzothiazol-3-one |
| SMILES | O=C1c2ccccc2S(=O)(=O)N1CCSc1ncc(-c2ccccc2)n1CC1CCCO1 |
| InChI | InChI=1S/C23H23N3O4S2/c27-22-19-10-4-5-11-21(19)32(28,29)26(22)12-14-31-23-24-15-20(17-7-2-1-3-8-17)25(23)16-18-9-6-13-30-18/h1-5,7-8,10-11,15,18H,6,9,12-14,16H2 |
| InChIKey | RXENMDZQZUZNBI-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_thio_5_A(8)', 'substructure': 'N/A'} |
|---|