C15H11CrNO5 — CID 11056840
carbon monoxide;1-(1,3-dihydroisoindol-2-yl)ethylidenechromium (PubChem CID 11056840) has the molecular formula C15H11CrNO5 and a molecular weight of 337.25 g/mol. Its IUPAC name is carbon monoxide;1-(1,3-dihydroisoindol-2-yl)ethylidenechromium.
| Compound Name | carbon monoxide;1-(1,3-dihydroisoindol-2-yl)ethylidenechromium |
|---|---|
| PubChem CID | 11056840 |
| Molecular Formula | C15H11CrNO5 |
| Molecular Weight | 337.25 g/mol |
| Exact Mass | 337.00 |
| IUPAC Name | carbon monoxide;1-(1,3-dihydroisoindol-2-yl)ethylidenechromium |
| SMILES | CC(=[Cr])N1Cc2ccccc2C1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+] |
| InChI | InChI=1S/C10H11N.5CO.Cr/c1-2-11-7-9-5-3-4-6-10(9)8-11;5*1-2;/h3-6H,7-8H2,1H3;;;;;; |
| InChIKey | RCLAZLYHWBSCOX-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 102.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.25 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|